Ferrous cevitamate
PubChem Notes:
Ascorbic Acid A six carbon compound related to glucose. It is found naturally in citrus fruits and many vegetables. Ascorbic acid is an essential nutrient in human diets, and necessary to maintain connective tissue and bone. Its biologically active form, vitamin C, functions as a reducing agent and coenzyme in several metabolic pathways. Vitamin C is considered an antioxidant.
Molecular Formula:
C12H16FeO12+2
InChI: InChI=1/2C6H8O6.Fe/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;/h2*2,5,7-8,10-11H,1H2;/q;;+2/t2*2-,5+;/m00./s1
InChIKey: InChIKey=QCVFXBHXHBXIGZ-ZZMNMWMABL
SMILES: C(C(C1C(=O)C(=C(O1)O)O)O)O.C(C(C1C(=O)C(=C(O1)O)O)O)O.[Fe+2]
Names:
Dihydrogen bis(L-ascorbato(2-)-02,03)ferrate(2-)
EINECS 246-469-7
Ferrate(2-), bis(L-ascorbato(2-)-02,03)-, dihydrogen
Ferrous ascorbate
Ferrous cevitamate
Iron(II) ascorbate
Iron(2+) di-L-ascorbate
Iron(2+) L-ascorbate
L-Ascorbic acid, iron complex
L-Ascorbic acid, iron(2+) salt (2:1)
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dihydroxy-furan-3-one; iron(+2) cation
Registries:
PubChem CID 62785
PubChem ID 204757
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|